Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Applied Biosystems™ POP-6™ Polymer, for 3500/SeqStudio™ Flex
POP-4, POP-6, and POP-7 are conveniently offered in easy to use pouch packages. The POP-6 separation matrix is optimized for standard sequencing and fragment analysis.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Product Line | POP-6 |
|---|
Applied Biosystems™ POP-4™ Polymer, for 3500/SeqStudio™ Flex
POP-4, POP-6, and POP-7 are conveniently offered in easy to use pouch packages. The POP-4 separation matrix is optimized for HID/forensic applications.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| For Use With (Application) | Human Identification |
|---|---|
| Product Line | POP-4 |
Polyethylene glycol 6,000
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Thermo Scientific Chemicals Cycloheximide, 95%
CAS: 66-81-9 Molecular Formula: C15H23NO4 Molecular Weight (g/mol): 281.35 MDL Number: MFCD00082346 InChI Key: YPHMISFOHDHNIV-QTEFRXOUNA-N Synonym: cycloheximide,actidione,cycloheximide,naramycin a,kaken,actidion,actidone,hizarocin,naramycin,neocycloheximide PubChem CID: 6197 ChEBI: CHEBI:27641 IUPAC Name: 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione SMILES: [H][C@]1(C[C@@H](C)C[C@H](C)C1=O)[C@H](O)CC1CC(=O)NC(=O)C1
| PubChem CID | 6197 |
|---|---|
| CAS | 66-81-9 |
| Molecular Weight (g/mol) | 281.35 |
| ChEBI | CHEBI:27641 |
| MDL Number | MFCD00082346 |
| SMILES | [H][C@]1(C[C@@H](C)C[C@H](C)C1=O)[C@H](O)CC1CC(=O)NC(=O)C1 |
| Synonym | cycloheximide,actidione,cycloheximide,naramycin a,kaken,actidion,actidone,hizarocin,naramycin,neocycloheximide |
| IUPAC Name | 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione |
| InChI Key | YPHMISFOHDHNIV-QTEFRXOUNA-N |
| Molecular Formula | C15H23NO4 |
Polyethylene glycol 8,000
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 8000 IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 8000 |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Guanidine hydrochloride, 98%
CAS: 50-01-1 Molecular Formula: CH6ClN3 Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735 IUPAC Name: guanidine;hydrochloride SMILES: C(=N)(N)N.Cl
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| SMILES | C(=N)(N)N.Cl |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| IUPAC Name | guanidine;hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3 |
Hemin (porcine), 97+%
CAS: 16009-13-5 Molecular Formula: C34H32ClFeN4O4 Molecular Weight (g/mol): 651.95 MDL Number: MFCD00010726 InChI Key: BTIJJDXEELBZFS-HXFTUNQESA-K Synonym: chlorohemin,hemin chloride,protoferriheme,ferriheme,ferriprotoporphyrin ix chloride,ferriprotoporphyrin ix,panhematin,protohemin,protohemin ix,ferriprotoporphyrin PubChem CID: 131675604 IUPAC Name: 3-[(1Z,6Z,12Z,17Z)-5-(2-carboxyethyl)-22-chloro-15,20-diethenyl-4,10,14,19-tetramethyl-21,23,24,25-tetraaza-22-ferrahexacyclo[9.9.3.1³,⁶.1¹³,¹⁶.0⁸,²³.0¹⁸,²¹]pentacosa-1,3(25),4,6,8,10,12,14,16(24),17,19-undecaen-9-yl]propanoic acid SMILES: CC1=C(CCC(O)=O)\C2=C\C3=C(CCC(O)=O)C(C)=C4\C=C5/N=C(/C=C6\N([Fe](Cl)N34)\C(=C/C1=N2)C(C=C)=C6C)C(C=C)=C5C
| PubChem CID | 131675604 |
|---|---|
| CAS | 16009-13-5 |
| Molecular Weight (g/mol) | 651.95 |
| MDL Number | MFCD00010726 |
| SMILES | CC1=C(CCC(O)=O)\C2=C\C3=C(CCC(O)=O)C(C)=C4\C=C5/N=C(/C=C6\N([Fe](Cl)N34)\C(=C/C1=N2)C(C=C)=C6C)C(C=C)=C5C |
| Synonym | chlorohemin,hemin chloride,protoferriheme,ferriheme,ferriprotoporphyrin ix chloride,ferriprotoporphyrin ix,panhematin,protohemin,protohemin ix,ferriprotoporphyrin |
| IUPAC Name | 3-[(1Z,6Z,12Z,17Z)-5-(2-carboxyethyl)-22-chloro-15,20-diethenyl-4,10,14,19-tetramethyl-21,23,24,25-tetraaza-22-ferrahexacyclo[9.9.3.1³,⁶.1¹³,¹⁶.0⁸,²³.0¹⁸,²¹]pentacosa-1,3(25),4,6,8,10,12,14,16(24),17,19-undecaen-9-yl]propanoic acid |
| InChI Key | BTIJJDXEELBZFS-HXFTUNQESA-K |
| Molecular Formula | C34H32ClFeN4O4 |
1,2-Dimethoxyethane 99.0+%, TCI America™
CAS: 110-71-4 Molecular Formula: C4H10O2 Molecular Weight (g/mol): 90.122 MDL Number: MFCD00008502 InChI Key: XTHFKEDIFFGKHM-UHFFFAOYSA-N Synonym: monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether PubChem CID: 8071 ChEBI: CHEBI:42263 IUPAC Name: 1,2-dimethoxyethane SMILES: COCCOC
| PubChem CID | 8071 |
|---|---|
| CAS | 110-71-4 |
| Molecular Weight (g/mol) | 90.122 |
| ChEBI | CHEBI:42263 |
| MDL Number | MFCD00008502 |
| SMILES | COCCOC |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| IUPAC Name | 1,2-dimethoxyethane |
| InChI Key | XTHFKEDIFFGKHM-UHFFFAOYSA-N |
| Molecular Formula | C4H10O2 |
Acetylacetone 99.0+%, TCI America™
CAS: 123-54-6 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00008787 InChI Key: YRKCREAYFQTBPV-UHFFFAOYSA-N Synonym: 2,4-pentanedione,acetylacetone,2,4-pentadione,diacetylmethane,acetoacetone,acac,2,4-dioxopentane,pentanedione,pentan-2,4-dione,acetyl acetone PubChem CID: 31261 ChEBI: CHEBI:14750 IUPAC Name: pentane-2,4-dione SMILES: CC(=O)CC(C)=O
| PubChem CID | 31261 |
|---|---|
| CAS | 123-54-6 |
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:14750 |
| MDL Number | MFCD00008787 |
| SMILES | CC(=O)CC(C)=O |
| Synonym | 2,4-pentanedione,acetylacetone,2,4-pentadione,diacetylmethane,acetoacetone,acac,2,4-dioxopentane,pentanedione,pentan-2,4-dione,acetyl acetone |
| IUPAC Name | pentane-2,4-dione |
| InChI Key | YRKCREAYFQTBPV-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Mineral oil, high purity
CAS: 8042-47-5 Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 MDL Number: MFCD00131611 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 8042-47-5 |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | MFCD00131611 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
Spermidine, 99%
CAS: 124-20-9 Molecular Formula: C7H19N3 Molecular Weight (g/mol): 145.25 MDL Number: MFCD00008229 InChI Key: ATHGHQPFGPMSJY-UHFFFAOYSA-N Synonym: spermidine,1,5,10-triazadecane,4-azaoctamethylenediamine,spermidin,4-azaoctane-1,8-diamine,n1-3-aminopropyl butane-1,4-diamine,1,4-butanediamine, n-3-aminopropyl,n-3-aminopropyl butane-1,4-diamine,n-3-aminopropyl-1,4-butane-diamine,1,4-diaminobutane, n-3-aminopropyl PubChem CID: 1102 ChEBI: CHEBI:16610 IUPAC Name: N'-(3-aminopropyl)butane-1,4-diamine SMILES: NCCCCNCCCN
| PubChem CID | 1102 |
|---|---|
| CAS | 124-20-9 |
| Molecular Weight (g/mol) | 145.25 |
| ChEBI | CHEBI:16610 |
| MDL Number | MFCD00008229 |
| SMILES | NCCCCNCCCN |
| Synonym | spermidine,1,5,10-triazadecane,4-azaoctamethylenediamine,spermidin,4-azaoctane-1,8-diamine,n1-3-aminopropyl butane-1,4-diamine,1,4-butanediamine, n-3-aminopropyl,n-3-aminopropyl butane-1,4-diamine,n-3-aminopropyl-1,4-butane-diamine,1,4-diaminobutane, n-3-aminopropyl |
| IUPAC Name | N'-(3-aminopropyl)butane-1,4-diamine |
| InChI Key | ATHGHQPFGPMSJY-UHFFFAOYSA-N |
| Molecular Formula | C7H19N3 |
Glutaraldehyde, 25% aq. soln.
CAS: 111-30-8 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00007025 InChI Key: SXRSQZLOMIGNAQ-UHFFFAOYSA-N Synonym: glutaraldehyde,glutaral,glutaric dialdehyde,cidex,glutardialdehyde,1,5-pentanedial,sonacide,glutarol,aldesan,glutaric aldehyde PubChem CID: 3485 ChEBI: CHEBI:64276 IUPAC Name: pentanedial SMILES: O=CCCCC=O
| PubChem CID | 3485 |
|---|---|
| CAS | 111-30-8 |
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:64276 |
| MDL Number | MFCD00007025 |
| SMILES | O=CCCCC=O |
| Synonym | glutaraldehyde,glutaral,glutaric dialdehyde,cidex,glutardialdehyde,1,5-pentanedial,sonacide,glutarol,aldesan,glutaric aldehyde |
| IUPAC Name | pentanedial |
| InChI Key | SXRSQZLOMIGNAQ-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
L-Ascorbic acid sodium salt, 99%
CAS: 134-03-2 Molecular Formula: C6H7NaO6 Molecular Weight (g/mol): 198.11 MDL Number: MFCD00082340 InChI Key: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate PubChem CID: 131674100 IUPAC Name: sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| PubChem CID | 131674100 |
|---|---|
| CAS | 134-03-2 |
| Molecular Weight (g/mol) | 198.11 |
| MDL Number | MFCD00082340 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Synonym | sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate |
| IUPAC Name | sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molecular Formula | C6H7NaO6 |
Serotonin hydrochloride, 98%
CAS: 153-98-0 Molecular Formula: C10H13ClN2O Molecular Weight (g/mol): 212.677 MDL Number: MFCD00012686 InChI Key: MDIGAZPGKJFIAH-UHFFFAOYSA-N Synonym: serotonin hydrochloride,5-hydroxytryptamine hydrochloride,3-2-aminoethyl-1h-indol-5-ol hydrochloride,serotonin hcl,5-hydroxytryptamine hcl,unii-gkn429m9vs,ccris 4420,1h-indol-5-ol, 3-2-aminoethyl-, monohydrochloride,gkn429m9vs,3-2-aminoethyl indol-5-ol, chloride PubChem CID: 160436 IUPAC Name: 3-(2-aminoethyl)-1H-indol-5-ol;hydrochloride SMILES: C1=CC2=C(C=C1O)C(=CN2)CCN.Cl
| PubChem CID | 160436 |
|---|---|
| CAS | 153-98-0 |
| Molecular Weight (g/mol) | 212.677 |
| MDL Number | MFCD00012686 |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CCN.Cl |
| Synonym | serotonin hydrochloride,5-hydroxytryptamine hydrochloride,3-2-aminoethyl-1h-indol-5-ol hydrochloride,serotonin hcl,5-hydroxytryptamine hcl,unii-gkn429m9vs,ccris 4420,1h-indol-5-ol, 3-2-aminoethyl-, monohydrochloride,gkn429m9vs,3-2-aminoethyl indol-5-ol, chloride |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol;hydrochloride |
| InChI Key | MDIGAZPGKJFIAH-UHFFFAOYSA-N |
| Molecular Formula | C10H13ClN2O |
Methyl acetate, 99%
CAS: 79-20-9 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.079 MDL Number: MFCD00008711 InChI Key: KXKVLQRXCPHEJC-UHFFFAOYSA-N Synonym: tereton,devoton,acetic acid, methyl ester,methyl ethanoate,acetic acid methyl ester,methylacetat,acetate de methyle,methylacetaat,methyl acetic ester,octan metylu PubChem CID: 6584 ChEBI: CHEBI:77700 IUPAC Name: methyl acetate SMILES: CC(=O)OC
| PubChem CID | 6584 |
|---|---|
| CAS | 79-20-9 |
| Molecular Weight (g/mol) | 74.079 |
| ChEBI | CHEBI:77700 |
| MDL Number | MFCD00008711 |
| SMILES | CC(=O)OC |
| Synonym | tereton,devoton,acetic acid, methyl ester,methyl ethanoate,acetic acid methyl ester,methylacetat,acetate de methyle,methylacetaat,methyl acetic ester,octan metylu |
| IUPAC Name | methyl acetate |
| InChI Key | KXKVLQRXCPHEJC-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |